About 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide
2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide (PubChem CID 140911440) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide.
Molecular Properties
| Compound Name | 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide |
| PubChem CID | 140911440 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide |
| SMILES | CC(C)(C)C1(NCC(N)=O)CC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2O/c1-8(2,3)9(14-4-7(13)15)5-10(11,12)6-9/h14H,4-6H2,1-3H3,(H2,13,15) |
| InChIKey | KPAQPJRKKKNDRZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide?
The IUPAC name of 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide (CID 140911440) is 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide.
What is the SMILES notation for 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide?
The canonical SMILES for 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide is CC(C)(C)C1(NCC(N)=O)CC(F)(F)C1.
What is the InChIKey of 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide?
The InChIKey is KPAQPJRKKKNDRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O/c1-8(2,3)9(14-4-7(13)15)5-10(11,12)6-9/h14H,4-6H2,1-3H3,(H2,13,15).
What are the key properties of 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide?
2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide has a molecular weight of 220.26 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-tert-butyl-3,3-difluorocyclobutyl)amino]acetamide is sourced from PubChem (CID 140911440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).