C22H22N2O — CID 140911448
(6aS,7S,11aS)-7,11a-dimethyl-2-phenyl-6,6a,7,11-tetrahydro-5H-[1]benzofuro[6,5-h]quinazoline (PubChem CID 140911448) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is (6aS,7S,11aS)-7,11a-dimethyl-2-phenyl-6,6a,7,11-tetrahydro-5H-[1]benzofuro[6,5-h]quinazoline.
| Compound Name | (6aS,7S,11aS)-7,11a-dimethyl-2-phenyl-6,6a,7,11-tetrahydro-5H-[1]benzofuro[6,5-h]quinazoline |
|---|---|
| PubChem CID | 140911448 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (6aS,7S,11aS)-7,11a-dimethyl-2-phenyl-6,6a,7,11-tetrahydro-5H-[1]benzofuro[6,5-h]quinazoline |
| SMILES | C[C@@H]1c2occc2C[C@]2(C)c3nc(-c4ccccc4)ncc3CC[C@@H]12 |
| InChI | InChI=1S/C22H22N2O/c1-14-18-9-8-17-13-23-21(15-6-4-3-5-7-15)24-20(17)22(18,2)12-16-10-11-25-19(14)16/h3-7,10-11,13-14,18H,8-9,12H2,1-2H3/t14-,18-,22-/m0/s1 |
| InChIKey | DZLGMHZYLSMFTR-SDYXESRWSA-N |
| XLogP | 4.92 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |