C17H20N2O2 — CID 140911459
(6aR,11aS)-7,7,11a-trimethyl-5,6,6a,11-tetrahydro-1H-[1]benzofuro[6,5-h]quinazolin-2-one (PubChem CID 140911459) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (6aR,11aS)-7,7,11a-trimethyl-5,6,6a,11-tetrahydro-1H-[1]benzofuro[6,5-h]quinazolin-2-one.
| Compound Name | (6aR,11aS)-7,7,11a-trimethyl-5,6,6a,11-tetrahydro-1H-[1]benzofuro[6,5-h]quinazolin-2-one |
|---|---|
| PubChem CID | 140911459 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (6aR,11aS)-7,7,11a-trimethyl-5,6,6a,11-tetrahydro-1H-[1]benzofuro[6,5-h]quinazolin-2-one |
| SMILES | CC1(C)c2occc2C[C@]2(C)c3[nH]c(=O)ncc3CC[C@@H]12 |
| InChI | InChI=1S/C17H20N2O2/c1-16(2)12-5-4-11-9-18-15(20)19-13(11)17(12,3)8-10-6-7-21-14(10)16/h6-7,9,12H,4-5,8H2,1-3H3,(H,18,19,20)/t12-,17-/m0/s1 |
| InChIKey | VNRHIOZXTPFWHJ-SJCJKPOMSA-N |
| XLogP | 2.72 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |