C26H26FN3O4 — CID 140911638
1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperidin-1-yl]-2-[[2-(6-fluoro-3-pyridinyl)-3-pyridinyl]oxy]ethanone (PubChem CID 140911638) has the molecular formula C26H26FN3O4 and a molecular weight of 463.51 g/mol. Its IUPAC name is 1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperidin-1-yl]-2-[[2-(6-fluoro-3-pyridinyl)-3-pyridinyl]oxy]ethanone.
| Compound Name | 1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperidin-1-yl]-2-[[2-(6-fluoro-3-pyridinyl)-3-pyridinyl]oxy]ethanone |
|---|---|
| PubChem CID | 140911638 |
| Molecular Formula | C26H26FN3O4 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperidin-1-yl]-2-[[2-(6-fluoro-3-pyridinyl)-3-pyridinyl]oxy]ethanone |
| SMILES | O=C(COc1cccnc1-c1ccc(F)nc1)N1CCC(CCc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C26H26FN3O4/c27-24-8-6-20(15-29-24)26-22(2-1-11-28-26)32-16-25(31)30-12-9-18(10-13-30)3-4-19-5-7-21-23(14-19)34-17-33-21/h1-2,5-8,11,14-15,18H,3-4,9-10,12-13,16-17H2 |
| InChIKey | QUNLGXZTHZUJGH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|