C8H6Cl2N4S — CID 14091213
[5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 14091213) has the molecular formula C8H6Cl2N4S and a molecular weight of 261.14 g/mol. Its IUPAC name is [5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 14091213 |
| Molecular Formula | C8H6Cl2N4S |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | [5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | NNc1nnc(-c2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C8H6Cl2N4S/c9-4-2-1-3-5(10)6(4)7-13-14-8(12-11)15-7/h1-3H,11H2,(H,12,14) |
| InChIKey | ZUZCTTFDIVHRKT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|