C10H10F3N5S — CID 140912410
2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 140912410) has the molecular formula C10H10F3N5S and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-4-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-4-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 140912410 |
| Molecular Formula | C10H10F3N5S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | CC1CNCc2nnc(-c3nc(C(F)(F)F)cs3)n21 |
| InChI | InChI=1S/C10H10F3N5S/c1-5-2-14-3-7-16-17-8(18(5)7)9-15-6(4-19-9)10(11,12)13/h4-5,14H,2-3H2,1H3 |
| InChIKey | RDVLIRRALLMISV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |