C15H25N5O2 — CID 140912443
tert-butyl 2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)pyrrolidine-1-carboxylate (PubChem CID 140912443) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is tert-butyl 2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140912443 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | tert-butyl 2-(5-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)pyrrolidine-1-carboxylate |
| SMILES | CC1CNCc2nnc(C3CCCN3C(=O)OC(C)(C)C)n21 |
| InChI | InChI=1S/C15H25N5O2/c1-10-8-16-9-12-17-18-13(20(10)12)11-6-5-7-19(11)14(21)22-15(2,3)4/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | PZIJACQZJZPEHL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |