C31H29FN6O5 — CID 140912447
4-[[4-fluoro-3-[5-methyl-3-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 140912447) has the molecular formula C31H29FN6O5 and a molecular weight of 584.61 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[5-methyl-3-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[5-methyl-3-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 140912447 |
| Molecular Formula | C31H29FN6O5 |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 4-[[4-fluoro-3-[5-methyl-3-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | COc1cc(-c2nnc3n2C(C)CN(C(=O)c2cc(Cc4n[nH]c(=O)c5ccccc45)ccc2F)C3)cc(OC)c1OC |
| InChI | InChI=1S/C31H29FN6O5/c1-17-15-37(16-27-34-35-29(38(17)27)19-13-25(41-2)28(43-4)26(14-19)42-3)31(40)22-11-18(9-10-23(22)32)12-24-20-7-5-6-8-21(20)30(39)36-33-24/h5-11,13-14,17H,12,15-16H2,1-4H3,(H,36,39) |
| InChIKey | ZUZRLXCYZQIIMX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |