C9H13FN4 — CID 140912694
N-[(3S,5S)-5-fluoropiperidin-3-yl]pyrimidin-2-amine (PubChem CID 140912694) has the molecular formula C9H13FN4 and a molecular weight of 196.23 g/mol. Its IUPAC name is N-[(3S,5S)-5-fluoropiperidin-3-yl]pyrimidin-2-amine.
| Compound Name | N-[(3S,5S)-5-fluoropiperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 140912694 |
| Molecular Formula | C9H13FN4 |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | N-[(3S,5S)-5-fluoropiperidin-3-yl]pyrimidin-2-amine |
| SMILES | F[C@@H]1CNC[C@@H](Nc2ncccn2)C1 |
| InChI | InChI=1S/C9H13FN4/c10-7-4-8(6-11-5-7)14-9-12-2-1-3-13-9/h1-3,7-8,11H,4-6H2,(H,12,13,14)/t7-,8-/m0/s1 |
| InChIKey | JYGVIWKKRFUIQW-YUMQZZPRSA-N |
| XLogP | 0.59 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |