C34H42N6O3 — CID 140912736
tert-butyl (3S)-3-[[4-[2-[5-(butylamino)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 140912736) has the molecular formula C34H42N6O3 and a molecular weight of 582.75 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[4-[2-[5-(butylamino)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[4-[2-[5-(butylamino)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140912736 |
| Molecular Formula | C34H42N6O3 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.33 |
| IUPAC Name | tert-butyl (3S)-3-[[4-[2-[5-(butylamino)-2-methylnaphthalen-1-yl]oxy-3-pyridinyl]pyrimidin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCCCNc1cccc2c(Oc3ncccc3-c3ccnc(N[C@H]4CCCN(C(=O)OC(C)(C)C)C4)n3)c(C)ccc12 |
| InChI | InChI=1S/C34H42N6O3/c1-6-7-18-35-28-14-8-12-26-25(28)16-15-23(2)30(26)42-31-27(13-9-19-36-31)29-17-20-37-32(39-29)38-24-11-10-21-40(22-24)33(41)43-34(3,4)5/h8-9,12-17,19-20,24,35H,6-7,10-11,18,21-22H2,1-5H3,(H,37,38,39)/t24-/m0/s1 |
| InChIKey | ITNOMAAADDZFOG-DEOSSOPVSA-N |
| XLogP | 7.82 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|