C20H22BFN2O4S — CID 140913171
ethyl 2-[5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 140913171) has the molecular formula C20H22BFN2O4S and a molecular weight of 416.28 g/mol. Its IUPAC name is ethyl 2-[5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 140913171 |
| Molecular Formula | C20H22BFN2O4S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | ethyl 2-[5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-n2cc(B3OC(C)(C)C(C)(C)O3)c3cc(F)ccc32)n1 |
| InChI | InChI=1S/C20H22BFN2O4S/c1-6-26-17(25)15-11-29-18(23-15)24-10-14(13-9-12(22)7-8-16(13)24)21-27-19(2,3)20(4,5)28-21/h7-11H,6H2,1-5H3 |
| InChIKey | DDYOLQVDNIMVSY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|