About copper(1+);1,10-phenanthroline;trifluoromethane
copper(1+);1,10-phenanthroline;trifluoromethane (PubChem CID 140913198) has the molecular formula C13H8CuF3N2
and a molecular weight of 312.76 g/mol. Its IUPAC name is copper(1+);1,10-phenanthroline;trifluoromethane.
Molecular Properties
| Compound Name | copper(1+);1,10-phenanthroline;trifluoromethane |
| PubChem CID | 140913198 |
| Molecular Formula | C13H8CuF3N2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | copper(1+);1,10-phenanthroline;trifluoromethane |
| SMILES | F[C-](F)F.[Cu+].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.CF3.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2-1(3)4;/h1-8H;;/q;-1;+1 |
| InChIKey | HFYRAUCEONFIPJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);1,10-phenanthroline;trifluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);1,10-phenanthroline;trifluoromethane?
The IUPAC name of copper(1+);1,10-phenanthroline;trifluoromethane (CID 140913198) is copper(1+);1,10-phenanthroline;trifluoromethane.
What is the SMILES notation for copper(1+);1,10-phenanthroline;trifluoromethane?
The canonical SMILES for copper(1+);1,10-phenanthroline;trifluoromethane is F[C-](F)F.[Cu+].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of copper(1+);1,10-phenanthroline;trifluoromethane?
The InChIKey is HFYRAUCEONFIPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.CF3.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2-1(3)4;/h1-8H;;/q;-1;+1.
What are the key properties of copper(1+);1,10-phenanthroline;trifluoromethane?
copper(1+);1,10-phenanthroline;trifluoromethane has a molecular weight of 312.76 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);1,10-phenanthroline;trifluoromethane is sourced from PubChem (CID 140913198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).