C16H14ClF3N6O2S — CID 140914175
2-chloro-5-ethylsulfonyl-6-[4-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-3-yl]pyridin-3-amine (PubChem CID 140914175) has the molecular formula C16H14ClF3N6O2S and a molecular weight of 446.84 g/mol. Its IUPAC name is 2-chloro-5-ethylsulfonyl-6-[4-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-3-yl]pyridin-3-amine.
| Compound Name | 2-chloro-5-ethylsulfonyl-6-[4-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 140914175 |
| Molecular Formula | C16H14ClF3N6O2S |
| Molecular Weight | 446.84 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 2-chloro-5-ethylsulfonyl-6-[4-methyl-5-[4-(trifluoromethyl)-2-pyridinyl]-1,2,4-triazol-3-yl]pyridin-3-amine |
| SMILES | CCS(=O)(=O)c1cc(N)c(Cl)nc1-c1nnc(-c2cc(C(F)(F)F)ccn2)n1C |
| InChI | InChI=1S/C16H14ClF3N6O2S/c1-3-29(27,28)11-7-9(21)13(17)23-12(11)15-25-24-14(26(15)2)10-6-8(4-5-22-10)16(18,19)20/h4-7H,3,21H2,1-2H3 |
| InChIKey | IDHRFFLPABXIPG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|