C26H26ClN5O4 — CID 140914444
[4-chloro-5-methoxy-2-[7-[(3S)-3-[(4-nitrophenyl)methylamino]pyrrolidin-1-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]methanol (PubChem CID 140914444) has the molecular formula C26H26ClN5O4 and a molecular weight of 507.98 g/mol. Its IUPAC name is [4-chloro-5-methoxy-2-[7-[(3S)-3-[(4-nitrophenyl)methylamino]pyrrolidin-1-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]methanol.
| Compound Name | [4-chloro-5-methoxy-2-[7-[(3S)-3-[(4-nitrophenyl)methylamino]pyrrolidin-1-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 140914444 |
| Molecular Formula | C26H26ClN5O4 |
| Molecular Weight | 507.98 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | [4-chloro-5-methoxy-2-[7-[(3S)-3-[(4-nitrophenyl)methylamino]pyrrolidin-1-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]methanol |
| SMILES | COc1cc(CO)c(-c2cn3ccc(N4CC[C@H](NCc5ccc([N+](=O)[O-])cc5)C4)cc3n2)cc1Cl |
| InChI | InChI=1S/C26H26ClN5O4/c1-36-25-10-18(16-33)22(12-23(25)27)24-15-31-9-7-21(11-26(31)29-24)30-8-6-19(14-30)28-13-17-2-4-20(5-3-17)32(34)35/h2-5,7,9-12,15,19,28,33H,6,8,13-14,16H2,1H3/t19-/m0/s1 |
| InChIKey | WKYDBZVQZXHUCR-IBGZPJMESA-N |
| XLogP | 4.43 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|