C29H38ClN5O5 — CID 140914461
tert-butyl N-[5-[4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]piperazin-1-yl]-5-oxopentyl]carbamate (PubChem CID 140914461) has the molecular formula C29H38ClN5O5 and a molecular weight of 572.11 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]piperazin-1-yl]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]piperazin-1-yl]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 140914461 |
| Molecular Formula | C29H38ClN5O5 |
| Molecular Weight | 572.11 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | tert-butyl N-[5-[4-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]piperazin-1-yl]-5-oxopentyl]carbamate |
| SMILES | COc1cc(OC)c(-c2cn3ccc(N4CCN(C(=O)CCCCNC(=O)OC(C)(C)C)CC4)cc3n2)cc1Cl |
| InChI | InChI=1S/C29H38ClN5O5/c1-29(2,3)40-28(37)31-10-7-6-8-27(36)34-14-12-33(13-15-34)20-9-11-35-19-23(32-26(35)16-20)21-17-22(30)25(39-5)18-24(21)38-4/h9,11,16-19H,6-8,10,12-15H2,1-5H3,(H,31,37) |
| InChIKey | IJJRLENUQALMPS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.11 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|