C15H23BrN4O2 — CID 140914655
tert-butyl N-[1-(5-bromopyrimidin-2-yl)piperidin-3-yl]-N-methylcarbamate (PubChem CID 140914655) has the molecular formula C15H23BrN4O2 and a molecular weight of 371.28 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromopyrimidin-2-yl)piperidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(5-bromopyrimidin-2-yl)piperidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 140914655 |
| Molecular Formula | C15H23BrN4O2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | tert-butyl N-[1-(5-bromopyrimidin-2-yl)piperidin-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCCN(c2ncc(Br)cn2)C1 |
| InChI | InChI=1S/C15H23BrN4O2/c1-15(2,3)22-14(21)19(4)12-6-5-7-20(10-12)13-17-8-11(16)9-18-13/h8-9,12H,5-7,10H2,1-4H3 |
| InChIKey | OWTQKMWTVQVDHC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |