C21H22ClN3O4 — CID 140914849
[1-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]piperidin-4-yl] formate (PubChem CID 140914849) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is [1-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]piperidin-4-yl] formate.
| Compound Name | [1-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]piperidin-4-yl] formate |
|---|---|
| PubChem CID | 140914849 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [1-[2-[5-chloro-2-(hydroxymethyl)-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]piperidin-4-yl] formate |
| SMILES | COc1cc(CO)c(-c2cn3ccc(N4CCC(OC=O)CC4)cc3n2)cc1Cl |
| InChI | InChI=1S/C21H22ClN3O4/c1-28-20-8-14(12-26)17(10-18(20)22)19-11-25-5-2-15(9-21(25)23-19)24-6-3-16(4-7-24)29-13-27/h2,5,8-11,13,16,26H,3-4,6-7,12H2,1H3 |
| InChIKey | LCSKRKYDWCJOHY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|