C6H13N — CID 140915145
1,1,1-trideuterio-3,3-dimethylbutan-2-imine (PubChem CID 140915145) has the molecular formula C6H13N and a molecular weight of 102.20 g/mol. Its IUPAC name is 1,1,1-trideuterio-3,3-dimethylbutan-2-imine.
| Compound Name | 1,1,1-trideuterio-3,3-dimethylbutan-2-imine |
|---|---|
| PubChem CID | 140915145 |
| Molecular Formula | C6H13N |
| Molecular Weight | 102.20 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | 1,1,1-trideuterio-3,3-dimethylbutan-2-imine |
| SMILES | [H]/N=C(\C([2H])([2H])[2H])C(C)(C)C |
| InChI | InChI=1S/C6H13N/c1-5(7)6(2,3)4/h7H,1-4H3/b7-5+/i1D3 |
| InChIKey | FLOXAHMOMHDWSA-PKJLGKQPSA-N |
| XLogP | 2.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|