C25H28N4O4 — CID 140915213
3,3,4,4-tetradeuterio-5-[7-[[dideuterio-[4-[dideuterio-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 140915213) has the molecular formula C25H28N4O4 and a molecular weight of 464.62 g/mol. Its IUPAC name is 3,3,4,4-tetradeuterio-5-[7-[[dideuterio-[4-[dideuterio-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3,3,4,4-tetradeuterio-5-[7-[[dideuterio-[4-[dideuterio-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 140915213 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 3,3,4,4-tetradeuterio-5-[7-[[dideuterio-[4-[dideuterio-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]phenyl]methyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C([2H])(Nc1cccc2c1CN(C1C(=O)NC(=O)C([2H])([2H])C1([2H])[2H])C2=O)c1ccc(C([2H])([2H])N2C([2H])([2H])C([2H])([2H])OC([2H])([2H])C2([2H])[2H])cc1 |
| InChI | InChI=1S/C25H28N4O4/c30-23-9-8-22(24(31)27-23)29-16-20-19(25(29)32)2-1-3-21(20)26-14-17-4-6-18(7-5-17)15-28-10-12-33-13-11-28/h1-7,22,26H,8-16H2,(H,27,30,31)/i8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2 |
| InChIKey | SGQYVCBNYMIUQV-MGXBQNAASA-N |
| XLogP | 1.89 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|