C26H25F6O3S+ — CID 140915935
diphenyl-[4-[4,4,4-trifluoro-3-(methoxymethoxy)-2-methyl-3-(trifluoromethyl)butan-2-yl]oxyphenyl]sulfanium (PubChem CID 140915935) has the molecular formula C26H25F6O3S+ and a molecular weight of 531.54 g/mol. Its IUPAC name is diphenyl-[4-[4,4,4-trifluoro-3-(methoxymethoxy)-2-methyl-3-(trifluoromethyl)butan-2-yl]oxyphenyl]sulfanium.
| Compound Name | diphenyl-[4-[4,4,4-trifluoro-3-(methoxymethoxy)-2-methyl-3-(trifluoromethyl)butan-2-yl]oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 140915935 |
| Molecular Formula | C26H25F6O3S+ |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | diphenyl-[4-[4,4,4-trifluoro-3-(methoxymethoxy)-2-methyl-3-(trifluoromethyl)butan-2-yl]oxyphenyl]sulfanium |
| SMILES | COCOC(C(F)(F)F)(C(F)(F)F)C(C)(C)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25F6O3S/c1-23(2,24(25(27,28)29,26(30,31)32)34-18-33-3)35-19-14-16-22(17-15-19)36(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,18H2,1-3H3/q+1 |
| InChIKey | LAKVRWRRMKWHEV-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|