C28H21F14O3S+ — CID 140915940
[4-[3,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(methoxymethoxy)pentoxy]phenyl]-diphenylsulfanium (PubChem CID 140915940) has the molecular formula C28H21F14O3S+ and a molecular weight of 703.51 g/mol. Its IUPAC name is [4-[3,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(methoxymethoxy)pentoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[3,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(methoxymethoxy)pentoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140915940 |
| Molecular Formula | C28H21F14O3S+ |
| Molecular Weight | 703.51 g/mol |
| Exact Mass | 703.10 |
| IUPAC Name | [4-[3,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-2-(methoxymethoxy)pentoxy]phenyl]-diphenylsulfanium |
| SMILES | COCOC(COc1ccc([S+](c2ccccc2)c2ccccc2)cc1)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H21F14O3S/c1-43-17-45-22(23(29,30)25(33,34)27(37,38)39,24(31,32)26(35,36)28(40,41)42)16-44-18-12-14-21(15-13-18)46(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15H,16-17H2,1H3/q+1 |
| InChIKey | FJRNYRUXTHFIJI-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.51 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|