C25H23F6O2S+ — CID 140915944
diphenyl-[4-[1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl]oxyphenyl]sulfanium (PubChem CID 140915944) has the molecular formula C25H23F6O2S+ and a molecular weight of 501.51 g/mol. Its IUPAC name is diphenyl-[4-[1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl]oxyphenyl]sulfanium.
| Compound Name | diphenyl-[4-[1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl]oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 140915944 |
| Molecular Formula | C25H23F6O2S+ |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | diphenyl-[4-[1,1,1-trifluoro-2-hydroxy-4-methyl-2-(trifluoromethyl)pentan-3-yl]oxyphenyl]sulfanium |
| SMILES | CC(C)C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H23F6O2S/c1-17(2)22(23(32,24(26,27)28)25(29,30)31)33-18-13-15-21(16-14-18)34(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-17,22,32H,1-2H3/q+1 |
| InChIKey | NAIFJVAMKWAPIN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|