C20H23F6O3S+ — CID 140915986
diethyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]sulfanium (PubChem CID 140915986) has the molecular formula C20H23F6O3S+ and a molecular weight of 457.46 g/mol. Its IUPAC name is diethyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]sulfanium.
| Compound Name | diethyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]sulfanium |
|---|---|
| PubChem CID | 140915986 |
| Molecular Formula | C20H23F6O3S+ |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | diethyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]sulfanium |
| SMILES | CC[S+](CC)c1ccc(OCC(OCOC)(C(F)(F)F)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C20H23F6O3S/c1-4-30(5-2)17-11-10-16(14-8-6-7-9-15(14)17)28-12-18(19(21,22)23,20(24,25)26)29-13-27-3/h6-11H,4-5,12-13H2,1-3H3/q+1 |
| InChIKey | PCBDCMJFTPJSPA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|