C22H25F6O4S+ — CID 140915987
1,1,1,3,3,3-hexafluoro-2-[[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-ium-4-yl]oxymethyl]propan-2-ol (PubChem CID 140915987) has the molecular formula C22H25F6O4S+ and a molecular weight of 499.49 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-ium-4-yl]oxymethyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-ium-4-yl]oxymethyl]propan-2-ol |
|---|---|
| PubChem CID | 140915987 |
| Molecular Formula | C22H25F6O4S+ |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-ium-4-yl]oxymethyl]propan-2-ol |
| SMILES | COCCOc1ccc([S+]2CCC(OCC(O)(C(F)(F)F)C(F)(F)F)CC2)c2ccccc12 |
| InChI | InChI=1S/C22H25F6O4S/c1-30-10-11-31-18-6-7-19(17-5-3-2-4-16(17)18)33-12-8-15(9-13-33)32-14-20(29,21(23,24)25)22(26,27)28/h2-7,15,29H,8-14H2,1H3/q+1 |
| InChIKey | LCTCAFBOCHNDRS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|