C18H17F6O3S+ — CID 140916004
1,1,1,3,3,3-hexafluoro-2-[[4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxymethyl]propan-2-ol (PubChem CID 140916004) has the molecular formula C18H17F6O3S+ and a molecular weight of 427.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxymethyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxymethyl]propan-2-ol |
|---|---|
| PubChem CID | 140916004 |
| Molecular Formula | C18H17F6O3S+ |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[4-(1,4-oxathian-4-ium-4-yl)naphthalen-1-yl]oxymethyl]propan-2-ol |
| SMILES | OC(COc1ccc([S+]2CCOCC2)c2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H17F6O3S/c19-17(20,21)16(25,18(22,23)24)11-27-14-5-6-15(28-9-7-26-8-10-28)13-4-2-1-3-12(13)14/h1-6,25H,7-11H2/q+1 |
| InChIKey | MHPJSOBWDSJGEE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|