C28H29F6O3S+ — CID 140916008
(4-tert-butylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium (PubChem CID 140916008) has the molecular formula C28H29F6O3S+ and a molecular weight of 559.59 g/mol. Its IUPAC name is (4-tert-butylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140916008 |
| Molecular Formula | C28H29F6O3S+ |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (4-tert-butylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
| SMILES | COCOC(COc1ccc([S+](c2ccccc2)c2ccc(C(C)(C)C)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H29F6O3S/c1-25(2,3)20-10-14-23(15-11-20)38(22-8-6-5-7-9-22)24-16-12-21(13-17-24)36-18-26(27(29,30)31,28(32,33)34)37-19-35-4/h5-17H,18-19H2,1-4H3/q+1 |
| InChIKey | ROIWWIXTJIROAX-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|