C24H21F6O3S+ — CID 140916013
diphenyl-[4-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethoxy]phenyl]sulfanium (PubChem CID 140916013) has the molecular formula C24H21F6O3S+ and a molecular weight of 503.48 g/mol. Its IUPAC name is diphenyl-[4-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethoxy]phenyl]sulfanium.
| Compound Name | diphenyl-[4-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140916013 |
| Molecular Formula | C24H21F6O3S+ |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | diphenyl-[4-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]ethoxy]phenyl]sulfanium |
| SMILES | OC(COCCOc1ccc([S+](c2ccccc2)c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H21F6O3S/c25-23(26,27)22(31,24(28,29)30)17-32-15-16-33-18-11-13-21(14-12-18)34(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,31H,15-17H2/q+1 |
| InChIKey | FLQMTEBEXSXLTA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|