C30H33F6O2S+ — CID 140916017
bis(4-tert-butylphenyl)-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium (PubChem CID 140916017) has the molecular formula C30H33F6O2S+ and a molecular weight of 571.65 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium.
| Compound Name | bis(4-tert-butylphenyl)-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140916017 |
| Molecular Formula | C30H33F6O2S+ |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | bis(4-tert-butylphenyl)-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(OCC(O)(C(F)(F)F)C(F)(F)F)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H33F6O2S/c1-26(2,3)20-7-13-23(14-8-20)39(24-15-9-21(10-16-24)27(4,5)6)25-17-11-22(12-18-25)38-19-28(37,29(31,32)33)30(34,35)36/h7-18,37H,19H2,1-6H3/q+1 |
| InChIKey | RAQJNVKUPKPYIS-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|