C21H21F6O4S+ — CID 140916025
1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thian-1-ium-4-one (PubChem CID 140916025) has the molecular formula C21H21F6O4S+ and a molecular weight of 483.45 g/mol. Its IUPAC name is 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thian-1-ium-4-one.
| Compound Name | 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thian-1-ium-4-one |
|---|---|
| PubChem CID | 140916025 |
| Molecular Formula | C21H21F6O4S+ |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 1-[4-[3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]naphthalen-1-yl]thian-1-ium-4-one |
| SMILES | COCOC(COc1ccc([S+]2CCC(=O)CC2)c2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H21F6O4S/c1-29-13-31-19(20(22,23)24,21(25,26)27)12-30-17-6-7-18(16-5-3-2-4-15(16)17)32-10-8-14(28)9-11-32/h2-7H,8-13H2,1H3/q+1 |
| InChIKey | BMNVCDCWWXCBJC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|