C17H28O4 — CID 140917385
ethyl 2-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-en-1-yl]acetate (PubChem CID 140917385) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is ethyl 2-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-en-1-yl]acetate.
| Compound Name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 140917385 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-en-1-yl]acetate |
| SMILES | CCOC(=O)CC1CC=C(C2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C17H28O4/c1-6-19-14(18)11-12-7-9-13(10-8-12)15-20-16(2,3)17(4,5)21-15/h9,12,15H,6-8,10-11H2,1-5H3 |
| InChIKey | WSRZOZBNBIUIQZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|