C12H24ClNO3 — CID 140917588
(2S)-1-(4-chloro-3-methylcyclohexyl)oxy-3-(2-hydroxyethylamino)propan-2-ol (PubChem CID 140917588) has the molecular formula C12H24ClNO3 and a molecular weight of 265.78 g/mol. Its IUPAC name is (2S)-1-(4-chloro-3-methylcyclohexyl)oxy-3-(2-hydroxyethylamino)propan-2-ol.
| Compound Name | (2S)-1-(4-chloro-3-methylcyclohexyl)oxy-3-(2-hydroxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 140917588 |
| Molecular Formula | C12H24ClNO3 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (2S)-1-(4-chloro-3-methylcyclohexyl)oxy-3-(2-hydroxyethylamino)propan-2-ol |
| SMILES | CC1CC(OC[C@@H](O)CNCCO)CCC1Cl |
| InChI | InChI=1S/C12H24ClNO3/c1-9-6-11(2-3-12(9)13)17-8-10(16)7-14-4-5-15/h9-12,14-16H,2-8H2,1H3/t9?,10-,11?,12?/m0/s1 |
| InChIKey | VLDHZELAKOBSMJ-GHNGPNRHSA-N |
| XLogP | 0.74 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|