C14H30NO3+ — CID 140917621
[(2R)-2-hydroxy-3-(4-methylcyclohexyl)oxypropyl]-(1-hydroxy-2-methylpropan-2-yl)azanium (PubChem CID 140917621) has the molecular formula C14H30NO3+ and a molecular weight of 260.40 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-(4-methylcyclohexyl)oxypropyl]-(1-hydroxy-2-methylpropan-2-yl)azanium.
| Compound Name | [(2R)-2-hydroxy-3-(4-methylcyclohexyl)oxypropyl]-(1-hydroxy-2-methylpropan-2-yl)azanium |
|---|---|
| PubChem CID | 140917621 |
| Molecular Formula | C14H30NO3+ |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | [(2R)-2-hydroxy-3-(4-methylcyclohexyl)oxypropyl]-(1-hydroxy-2-methylpropan-2-yl)azanium |
| SMILES | CC1CCC(OC[C@H](O)C[NH2+]C(C)(C)CO)CC1 |
| InChI | InChI=1S/C14H29NO3/c1-11-4-6-13(7-5-11)18-9-12(17)8-15-14(2,3)10-16/h11-13,15-17H,4-10H2,1-3H3/p+1/t11?,12-,13?/m1/s1 |
| InChIKey | SEQHLXGKFYPUTM-OTTFEQOBSA-O |
| XLogP | 0.28 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |