C16H33N3O+2 — CID 140917663
4-methyl-N-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine (PubChem CID 140917663) has the molecular formula C16H33N3O+2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 4-methyl-N-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine.
| Compound Name | 4-methyl-N-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine |
|---|---|
| PubChem CID | 140917663 |
| Molecular Formula | C16H33N3O+2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 4-methyl-N-(2-morpholin-4-ium-4-ylethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-2-amine |
| SMILES | CC1CC(NCC[NH+]2CCOCC2)[NH2+]C2CCCCC12 |
| InChI | InChI=1S/C16H31N3O/c1-13-12-16(18-15-5-3-2-4-14(13)15)17-6-7-19-8-10-20-11-9-19/h13-18H,2-12H2,1H3/p+2 |
| InChIKey | PLUIHMWMDMEEGM-UHFFFAOYSA-P |
| XLogP | -1.02 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |