C13H21N4OS+ — CID 140917707
1-(2-piperazin-1-ium-1-ylethyl)-4-sulfanylidene-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-one (PubChem CID 140917707) has the molecular formula C13H21N4OS+ and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(2-piperazin-1-ium-1-ylethyl)-4-sulfanylidene-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-one.
| Compound Name | 1-(2-piperazin-1-ium-1-ylethyl)-4-sulfanylidene-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-one |
|---|---|
| PubChem CID | 140917707 |
| Molecular Formula | C13H21N4OS+ |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(2-piperazin-1-ium-1-ylethyl)-4-sulfanylidene-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)c2c(n1CC[NH+]1CCNCC1)CCC2 |
| InChI | InChI=1S/C13H20N4OS/c18-13-15-12(19)10-2-1-3-11(10)17(13)9-8-16-6-4-14-5-7-16/h14H,1-9H2,(H,15,18,19)/p+1 |
| InChIKey | NYQZPXPIMVWFIM-UHFFFAOYSA-O |
| XLogP | -1.12 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|