C15H22N3OS- — CID 140917757
6-[(4-methylcyclohexyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thiolate (PubChem CID 140917757) has the molecular formula C15H22N3OS- and a molecular weight of 292.43 g/mol. Its IUPAC name is 6-[(4-methylcyclohexyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thiolate.
| Compound Name | 6-[(4-methylcyclohexyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thiolate |
|---|---|
| PubChem CID | 140917757 |
| Molecular Formula | C15H22N3OS- |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-[(4-methylcyclohexyl)methyl]-4-oxo-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thiolate |
| SMILES | CC1CCC(CN2CCc3nc([S-])[nH]c(=O)c3C2)CC1 |
| InChI | InChI=1S/C15H23N3OS/c1-10-2-4-11(5-3-10)8-18-7-6-13-12(9-18)14(19)17-15(20)16-13/h10-11H,2-9H2,1H3,(H2,16,17,19,20)/p-1 |
| InChIKey | CAYLNZOETJFSCS-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|