C15H23N3OS — CID 140917758
6-[(4-methylcyclohexyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 140917758) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 6-[(4-methylcyclohexyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(4-methylcyclohexyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 140917758 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 6-[(4-methylcyclohexyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC1CCC(CN2CCc3[nH]c(=S)[nH]c(=O)c3C2)CC1 |
| InChI | InChI=1S/C15H23N3OS/c1-10-2-4-11(5-3-10)8-18-7-6-13-12(9-18)14(19)17-15(20)16-13/h10-11H,2-9H2,1H3,(H2,16,17,19,20) |
| InChIKey | CAYLNZOETJFSCS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|