About 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol
4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol (PubChem CID 140918384) has the molecular formula C21H24NO2+
and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol.
Molecular Properties
| Compound Name | 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol |
| PubChem CID | 140918384 |
| Molecular Formula | C21H24NO2+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol |
| SMILES | C=CC1=[N+](CCCOc2ccc(O)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C21H23NO2/c1-4-20-21(2,3)18-8-5-6-9-19(18)22(20)14-7-15-24-17-12-10-16(23)11-13-17/h4-6,8-13H,1,7,14-15H2,2-3H3/p+1 |
| InChIKey | RPNAFGFQBWYKIG-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol?
The IUPAC name of 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol (CID 140918384) is 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol.
What is the SMILES notation for 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol?
The canonical SMILES for 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol is C=CC1=[N+](CCCOc2ccc(O)cc2)c2ccccc2C1(C)C.
What is the InChIKey of 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol?
The InChIKey is RPNAFGFQBWYKIG-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H23NO2/c1-4-20-21(2,3)18-8-5-6-9-19(18)22(20)14-7-15-24-17-12-10-16(23)11-13-17/h4-6,8-13H,1,7,14-15H2,2-3H3/p+1.
What are the key properties of 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol?
4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol has a molecular weight of 322.43 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2-ethenyl-3,3-dimethylindol-1-ium-1-yl)propoxy]phenol is sourced from PubChem (CID 140918384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).