C32H47BO4 — CID 140918441
2-[3-(3,5-ditert-butylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140918441) has the molecular formula C32H47BO4 and a molecular weight of 506.54 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(3,5-ditert-butylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140918441 |
| Molecular Formula | C32H47BO4 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | 2-[3-(3,5-ditert-butylphenyl)-5-methyl-2-(oxan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)c(OC2CCCCO2)c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C32H47BO4/c1-21-16-25(22-18-23(29(2,3)4)20-24(19-22)30(5,6)7)28(35-27-14-12-13-15-34-27)26(17-21)33-36-31(8,9)32(10,11)37-33/h16-20,27H,12-15H2,1-11H3 |
| InChIKey | MCAIZUJPRPQMTB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|