C35H56F3NO — CID 140918477
2,2,2-trifluoro-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]-N-methylacetamide (PubChem CID 140918477) has the molecular formula C35H56F3NO and a molecular weight of 563.83 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]-N-methylacetamide.
| Compound Name | 2,2,2-trifluoro-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 140918477 |
| Molecular Formula | C35H56F3NO |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.43 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]-N-methylacetamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCCN(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C35H56F3NO/c1-28(2)16-11-19-31(5)22-12-20-29(3)17-9-10-18-30(4)21-13-23-32(6)24-14-25-33(7)26-15-27-39(8)34(40)35(36,37)38/h16-18,22-23,25H,9-15,19-21,24,26-27H2,1-8H3/b29-17+,30-18+,31-22+,32-23+,33-25+ |
| InChIKey | SPLPJAWBAWCJDY-LZRZEKPOSA-N |
| XLogP | 11.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|