C52H44N2OSSi — CID 140919955
[4-(1-deuteriocyclopentyl)-3-[8-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzothiazol-7-yl]phenyl]-(9,9-dimethylxanthen-4-yl)-diphenylsilane (PubChem CID 140919955) has the molecular formula C52H44N2OSSi and a molecular weight of 777.11 g/mol. Its IUPAC name is [4-(1-deuteriocyclopentyl)-3-[8-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzothiazol-7-yl]phenyl]-(9,9-dimethylxanthen-4-yl)-diphenylsilane.
| Compound Name | [4-(1-deuteriocyclopentyl)-3-[8-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzothiazol-7-yl]phenyl]-(9,9-dimethylxanthen-4-yl)-diphenylsilane |
|---|---|
| PubChem CID | 140919955 |
| Molecular Formula | C52H44N2OSSi |
| Molecular Weight | 777.11 g/mol |
| Exact Mass | 776.32 |
| IUPAC Name | [4-(1-deuteriocyclopentyl)-3-[8-(trideuteriomethyl)benzimidazolo[2,1-b][1,3]benzothiazol-7-yl]phenyl]-(9,9-dimethylxanthen-4-yl)-diphenylsilane |
| SMILES | [2H]C([2H])([2H])c1ccc2c(nc3sc4ccccc4n32)c1-c1cc([Si](c2ccccc2)(c2ccccc2)c2cccc3c2Oc2ccccc2C3(C)C)ccc1C1([2H])CCCC1 |
| InChI | InChI=1S/C52H44N2OSSi/c1-34-29-32-44-49(53-51-54(44)43-25-13-15-27-46(43)56-51)48(34)40-33-38(30-31-39(40)35-17-10-11-18-35)57(36-19-6-4-7-20-36,37-21-8-5-9-22-37)47-28-16-24-42-50(47)55-45-26-14-12-23-41(45)52(42,2)3/h4-9,12-16,19-33,35H,10-11,17-18H2,1-3H3/i1D3,35D |
| InChIKey | IFOUXASBAQLYGU-PYLGAELCSA-N |
| XLogP | 11.14 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.11 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|