C49H42N4OS2 — CID 140920020
4-[7-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-3,6-ditert-butyl-9,9-dimethylxanthen-2-yl]benzimidazolo[2,1-b][1,3]benzothiazole (PubChem CID 140920020) has the molecular formula C49H42N4OS2 and a molecular weight of 767.04 g/mol. Its IUPAC name is 4-[7-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-3,6-ditert-butyl-9,9-dimethylxanthen-2-yl]benzimidazolo[2,1-b][1,3]benzothiazole.
| Compound Name | 4-[7-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-3,6-ditert-butyl-9,9-dimethylxanthen-2-yl]benzimidazolo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 140920020 |
| Molecular Formula | C49H42N4OS2 |
| Molecular Weight | 767.04 g/mol |
| Exact Mass | 766.28 |
| IUPAC Name | 4-[7-(benzimidazolo[2,1-b][1,3]benzothiazol-4-yl)-3,6-ditert-butyl-9,9-dimethylxanthen-2-yl]benzimidazolo[2,1-b][1,3]benzothiazole |
| SMILES | CC(C)(C)c1cc2c(cc1-c1cccc3c1sc1nc4ccccc4n13)C(C)(C)c1cc(-c3cccc4c3sc3nc5ccccc5n34)c(C(C)(C)C)cc1O2 |
| InChI | InChI=1S/C49H42N4OS2/c1-47(2,3)31-25-41-33(23-29(31)27-15-13-21-39-43(27)55-45-50-35-17-9-11-19-37(35)52(39)45)49(7,8)34-24-30(32(48(4,5)6)26-42(34)54-41)28-16-14-22-40-44(28)56-46-51-36-18-10-12-20-38(36)53(40)46/h9-26H,1-8H3 |
| InChIKey | IRJKIEBKGDTESL-UHFFFAOYSA-N |
| XLogP | 14.08 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.04 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |