C60H54N2OSSi — CID 140920062
[3-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-4-tert-butylphenyl]-[4-tert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-diphenylsilane (PubChem CID 140920062) has the molecular formula C60H54N2OSSi and a molecular weight of 879.26 g/mol. Its IUPAC name is [3-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-4-tert-butylphenyl]-[4-tert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-diphenylsilane.
| Compound Name | [3-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-4-tert-butylphenyl]-[4-tert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 140920062 |
| Molecular Formula | C60H54N2OSSi |
| Molecular Weight | 879.26 g/mol |
| Exact Mass | 878.37 |
| IUPAC Name | [3-(benzimidazolo[2,1-b][1,3]benzothiazol-7-yl)-4-tert-butylphenyl]-[4-tert-butyl-3-(9,9-dimethylxanthen-4-yl)phenyl]-diphenylsilane |
| SMILES | CC(C)(C)c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(C(C)(C)C)c(-c3cccc4c3nc3sc5ccccc5n34)c2)cc1-c1cccc2c1Oc1ccccc1C2(C)C |
| InChI | InChI=1S/C60H54N2OSSi/c1-58(2,3)47-35-33-41(37-45(47)43-25-20-30-52-55(43)61-57-62(52)51-29-16-18-32-54(51)64-57)65(39-21-11-9-12-22-39,40-23-13-10-14-24-40)42-34-36-48(59(4,5)6)46(38-42)44-26-19-28-50-56(44)63-53-31-17-15-27-49(53)60(50,7)8/h9-38H,1-8H3 |
| InChIKey | ZHAMUZIPAZVQLS-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.26 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|