C76H57NS — CID 140920269
6-[2,4,6-tris(2-deuteriopropan-2-yl)-3-(7-dibenzothiophen-4-yltetraphenylen-2-yl)phenyl]tetraphenylene-2-carbonitrile (PubChem CID 140920269) has the molecular formula C76H57NS and a molecular weight of 1019.38 g/mol. Its IUPAC name is 6-[2,4,6-tris(2-deuteriopropan-2-yl)-3-(7-dibenzothiophen-4-yltetraphenylen-2-yl)phenyl]tetraphenylene-2-carbonitrile.
| Compound Name | 6-[2,4,6-tris(2-deuteriopropan-2-yl)-3-(7-dibenzothiophen-4-yltetraphenylen-2-yl)phenyl]tetraphenylene-2-carbonitrile |
|---|---|
| PubChem CID | 140920269 |
| Molecular Formula | C76H57NS |
| Molecular Weight | 1019.38 g/mol |
| Exact Mass | 1018.44 |
| IUPAC Name | 6-[2,4,6-tris(2-deuteriopropan-2-yl)-3-(7-dibenzothiophen-4-yltetraphenylen-2-yl)phenyl]tetraphenylene-2-carbonitrile |
| SMILES | [2H]C(C)(C)c1cc(C([2H])(C)C)c(-c2ccc3c(c2)-c2ccc(C#N)cc2-c2ccccc2-c2ccccc2-3)c(C([2H])(C)C)c1-c1ccc2c(c1)-c1ccccc1-c1ccccc1-c1cc(-c3cccc4c3sc3ccccc34)ccc1-2 |
| InChI | InChI=1S/C76H57NS/c1-44(2)66-42-67(45(3)4)75(50-32-36-60-56-22-8-7-18-52(56)53-19-9-12-23-57(53)68-38-47(43-77)30-34-63(68)71(60)41-50)73(46(5)6)74(66)49-33-37-62-61-35-31-48(51-27-17-28-65-64-26-15-16-29-72(64)78-76(51)65)39-69(61)58-24-13-10-20-54(58)55-21-11-14-25-59(55)70(62)40-49/h7-42,44-46H,1-6H3/b53-52-,55-54-,60-56-,62-61-,68-57-,69-58-,70-59-,71-63-/i44D,45D,46D |
| InChIKey | LOSYWUUAERMZSM-XYDDIGIWSA-N |
| XLogP | 22.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.38 |
| LogP ≤ 5 | 22.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |