C28H28N+ — CID 140920651
4-[2,6-bis(trideuteriomethyl)phenyl]-1-methyl-2-(2-methyl-5-phenylphenyl)-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 140920651) has the molecular formula C28H28N+ and a molecular weight of 387.59 g/mol. Its IUPAC name is 4-[2,6-bis(trideuteriomethyl)phenyl]-1-methyl-2-(2-methyl-5-phenylphenyl)-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-[2,6-bis(trideuteriomethyl)phenyl]-1-methyl-2-(2-methyl-5-phenylphenyl)-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140920651 |
| Molecular Formula | C28H28N+ |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | 4-[2,6-bis(trideuteriomethyl)phenyl]-1-methyl-2-(2-methyl-5-phenylphenyl)-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2cc(-c3ccccc3)ccc2C)cc1-c1c(C([2H])([2H])[2H])cccc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C28H28N/c1-19-14-15-24(23-12-7-6-8-13-23)16-25(19)27-17-26(22(4)18-29(27)5)28-20(2)10-9-11-21(28)3/h6-18H,1-5H3/q+1/i2D3,3D3,4D3 |
| InChIKey | FSFHCPMRSNMCOZ-WVZRYRIDSA-N |
| XLogP | 6.75 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|