C23H22F3N2S+ — CID 140920884
3-methyl-4-[2-methyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidin-3-ium (PubChem CID 140920884) has the molecular formula C23H22F3N2S+ and a molecular weight of 415.50 g/mol. Its IUPAC name is 3-methyl-4-[2-methyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidin-3-ium.
| Compound Name | 3-methyl-4-[2-methyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 140920884 |
| Molecular Formula | C23H22F3N2S+ |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-methyl-4-[2-methyl-5-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-[1]benzothiolo[3,2-d]pyrimidin-3-ium |
| SMILES | Cc1ccc(CC(C)(C)C(F)(F)F)cc1-c1c2sc3ccccc3c2nc[n+]1C |
| InChI | InChI=1S/C23H22F3N2S/c1-14-9-10-15(12-22(2,3)23(24,25)26)11-17(14)20-21-19(27-13-28(20)4)16-7-5-6-8-18(16)29-21/h5-11,13H,12H2,1-4H3/q+1 |
| InChIKey | LHCLIWBAPPHHPN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|