C27H25F2N9 — CID 140921256
7-fluoro-6-(8-fluoro-4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine (PubChem CID 140921256) has the molecular formula C27H25F2N9 and a molecular weight of 513.56 g/mol. Its IUPAC name is 7-fluoro-6-(8-fluoro-4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine.
| Compound Name | 7-fluoro-6-(8-fluoro-4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine |
|---|---|
| PubChem CID | 140921256 |
| Molecular Formula | C27H25F2N9 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 7-fluoro-6-(8-fluoro-4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-3-N-(1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraen-12-yl)isoquinoline-3,8-diamine |
| SMILES | Cc1c(-c2cc3cc(Nc4cc5n(n4)Cc4nccn4CC5)ncc3c(N)c2F)cnc2c1NCCC2F |
| InChI | InChI=1S/C27H25F2N9/c1-14-18(11-34-27-20(28)2-4-32-26(14)27)17-8-15-9-21(33-12-19(15)25(30)24(17)29)35-22-10-16-3-6-37-7-5-31-23(37)13-38(16)36-22/h5,7-12,20,32H,2-4,6,13,30H2,1H3,(H,33,35,36) |
| InChIKey | KPMVQVRNOULKST-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|