C19H20N6O2 — CID 140921423
cis-(1S,2S)-N-[8-amino-6-(2-methyl-6-oxopiperazin-1-yl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide (PubChem CID 140921423) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is cis-(1S,2S)-N-[8-amino-6-(2-methyl-6-oxopiperazin-1-yl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[8-amino-6-(2-methyl-6-oxopiperazin-1-yl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140921423 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | cis-(1S,2S)-N-[8-amino-6-(2-methyl-6-oxopiperazin-1-yl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
| SMILES | CC1CNCC(=O)N1c1cc(N)c2cnc(NC(=O)[C@H]3C[C@@H]3C#N)cc2c1 |
| InChI | InChI=1S/C19H20N6O2/c1-10-7-22-9-18(26)25(10)13-2-11-4-17(23-8-15(11)16(21)5-13)24-19(27)14-3-12(14)6-20/h2,4-5,8,10,12,14,22H,3,7,9,21H2,1H3,(H,23,24,27)/t10?,12-,14+/m1/s1 |
| InChIKey | HGDIQXDJRIXOJV-VOHIISRTSA-N |
| XLogP | 1.24 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|