C21H19N5O2 — CID 140921478
cis-(1S,2S)-N-[8-amino-6-[4-(2-hydroxyethyl)-3-pyridinyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide (PubChem CID 140921478) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is cis-(1S,2S)-N-[8-amino-6-[4-(2-hydroxyethyl)-3-pyridinyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[8-amino-6-[4-(2-hydroxyethyl)-3-pyridinyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140921478 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | cis-(1S,2S)-N-[8-amino-6-[4-(2-hydroxyethyl)-3-pyridinyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
| SMILES | N#C[C@H]1C[C@@H]1C(=O)Nc1cc2cc(-c3cnccc3CCO)cc(N)c2cn1 |
| InChI | InChI=1S/C21H19N5O2/c22-9-15-6-16(15)21(28)26-20-8-14-5-13(7-19(23)18(14)11-25-20)17-10-24-3-1-12(17)2-4-27/h1,3,5,7-8,10-11,15-16,27H,2,4,6,23H2,(H,25,26,28)/t15-,16+/m1/s1 |
| InChIKey | UVRJOSJDPZNSJY-CVEARBPZSA-N |
| XLogP | 2.51 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|