C18H19N5 — CID 140921698
6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinoline-3,8-diamine (PubChem CID 140921698) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is 6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinoline-3,8-diamine.
| Compound Name | 6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinoline-3,8-diamine |
|---|---|
| PubChem CID | 140921698 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinoline-3,8-diamine |
| SMILES | Cc1c(-c2cc(N)c3cnc(N)cc3c2)cnc2c1NCCC2 |
| InChI | InChI=1S/C18H19N5/c1-10-13(8-22-16-3-2-4-21-18(10)16)11-5-12-7-17(20)23-9-14(12)15(19)6-11/h5-9,21H,2-4,19H2,1H3,(H2,20,23) |
| InChIKey | LKPFGXMJZTWLME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|