About 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine
5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine (PubChem CID 140921870) has the molecular formula C15H33NO
and a molecular weight of 243.43 g/mol. Its IUPAC name is 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine.
Molecular Properties
| Compound Name | 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine |
| PubChem CID | 140921870 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine |
| SMILES | COC(C(C)C)C(C)C(C(C)C)N(C)C(C)C |
| InChI | InChI=1S/C15H33NO/c1-10(2)14(16(8)12(5)6)13(7)15(17-9)11(3)4/h10-15H,1-9H3 |
| InChIKey | DJAVXRKVZCDFIO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine?
The IUPAC name of 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine (CID 140921870) is 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine.
What is the SMILES notation for 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine?
The canonical SMILES for 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine is COC(C(C)C)C(C)C(C(C)C)N(C)C(C)C.
What is the InChIKey of 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine?
The InChIKey is DJAVXRKVZCDFIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO/c1-10(2)14(16(8)12(5)6)13(7)15(17-9)11(3)4/h10-15H,1-9H3.
What are the key properties of 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine?
5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine has a molecular weight of 243.43 g/mol, XLogP of 3.66, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-N,2,4,6-tetramethyl-N-propan-2-ylheptan-3-amine is sourced from PubChem (CID 140921870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).